C21H21BrO5 — CID 24652421
(E)-3-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one (PubChem CID 24652421) has the molecular formula C21H21BrO5 and a molecular weight of 433.30 g/mol. Its IUPAC name is (E)-3-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24652421 |
| Molecular Formula | C21H21BrO5 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | (E)-3-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCOc1c(Br)cc(/C=C/C(=O)c2ccc(O)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C21H21BrO5/c1-4-10-27-21-16(22)11-14(12-20(21)26-5-2)6-8-17(23)15-7-9-18(24)19(13-15)25-3/h4,6-9,11-13,24H,1,5,10H2,2-3H3/b8-6+ |
| InChIKey | WMMRJZMTMJQSQJ-SOFGYWHQSA-N |
| XLogP | 5.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|