C17H15BrO4 — CID 8014534
(E)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 8014534) has the molecular formula C17H15BrO4 and a molecular weight of 363.21 g/mol. Its IUPAC name is (E)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8014534 |
| Molecular Formula | C17H15BrO4 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (E)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccc(O)cc2)cc(Br)c1O |
| InChI | InChI=1S/C17H15BrO4/c1-2-22-16-10-11(9-14(18)17(16)21)3-8-15(20)12-4-6-13(19)7-5-12/h3-10,19,21H,2H2,1H3/b8-3+ |
| InChIKey | AKXVETRAYNEUCK-FPYGCLRLSA-N |
| XLogP | 4.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|