C20H22BrNO5S — CID 4813599
4-[3-(3-bromo-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 4813599) has the molecular formula C20H22BrNO5S and a molecular weight of 468.37 g/mol. Its IUPAC name is 4-[3-(3-bromo-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[3-(3-bromo-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4813599 |
| Molecular Formula | C20H22BrNO5S |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 4-[3-(3-bromo-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CCOc1cc(C=CC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)cc(Br)c1OC |
| InChI | InChI=1S/C20H22BrNO5S/c1-5-27-19-13-14(12-17(21)20(19)26-4)6-11-18(23)15-7-9-16(10-8-15)28(24,25)22(2)3/h6-13H,5H2,1-4H3 |
| InChIKey | MJXASTKSBDBBTA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|