C25H25NO5S — CID 4812918
4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 4812918) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is 4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4812918 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 4-[3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C=CC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H25NO5S/c1-26(2)32(28,29)22-13-11-21(12-14-22)23(27)15-9-19-10-16-24(25(17-19)30-3)31-18-20-7-5-4-6-8-20/h4-17H,18H2,1-3H3 |
| InChIKey | FSKLASRXAORWDK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|