C20H21NO6S — CID 24650417
2-[[4-[(E)-3-(4-methoxy-3-methylphenyl)prop-2-enoyl]phenyl]sulfonyl-methylamino]acetic acid (PubChem CID 24650417) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-[[4-[(E)-3-(4-methoxy-3-methylphenyl)prop-2-enoyl]phenyl]sulfonyl-methylamino]acetic acid.
| Compound Name | 2-[[4-[(E)-3-(4-methoxy-3-methylphenyl)prop-2-enoyl]phenyl]sulfonyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 24650417 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-[[4-[(E)-3-(4-methoxy-3-methylphenyl)prop-2-enoyl]phenyl]sulfonyl-methylamino]acetic acid |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(S(=O)(=O)N(C)CC(=O)O)cc2)cc1C |
| InChI | InChI=1S/C20H21NO6S/c1-14-12-15(5-11-19(14)27-3)4-10-18(22)16-6-8-17(9-7-16)28(25,26)21(2)13-20(23)24/h4-12H,13H2,1-3H3,(H,23,24)/b10-4+ |
| InChIKey | ILAJFLHERSYPOP-ONNFQVAWSA-N |
| XLogP | 2.60 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|