C22H19NO5S — CID 24650373
2-[methyl-[4-[(E)-3-naphthalen-1-ylprop-2-enoyl]phenyl]sulfonylamino]acetic acid (PubChem CID 24650373) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-[methyl-[4-[(E)-3-naphthalen-1-ylprop-2-enoyl]phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[methyl-[4-[(E)-3-naphthalen-1-ylprop-2-enoyl]phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 24650373 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-[methyl-[4-[(E)-3-naphthalen-1-ylprop-2-enoyl]phenyl]sulfonylamino]acetic acid |
| SMILES | CN(CC(=O)O)S(=O)(=O)c1ccc(C(=O)/C=C/c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H19NO5S/c1-23(15-22(25)26)29(27,28)19-12-9-18(10-13-19)21(24)14-11-17-7-4-6-16-5-2-3-8-20(16)17/h2-14H,15H2,1H3,(H,25,26)/b14-11+ |
| InChIKey | WNWMVAHBWODVIO-SDNWHVSQSA-N |
| XLogP | 3.44 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|