C33H31BrN2O5S — CID 171390902
1-[4-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]phenyl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 171390902) has the molecular formula C33H31BrN2O5S and a molecular weight of 647.59 g/mol. Its IUPAC name is 1-[4-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]phenyl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]phenyl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 171390902 |
| Molecular Formula | C33H31BrN2O5S |
| Molecular Weight | 647.59 g/mol |
| Exact Mass | 646.11 |
| IUPAC Name | 1-[4-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]phenyl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc(N3CCN(S(=O)(=O)c4ccc(Br)cc4)CC3)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H31BrN2O5S/c1-40-33-23-25(8-18-32(33)41-24-26-5-3-2-4-6-26)7-17-31(37)27-9-13-29(14-10-27)35-19-21-36(22-20-35)42(38,39)30-15-11-28(34)12-16-30/h2-18,23H,19-22,24H2,1H3 |
| InChIKey | FPHBAOUQTYLCPW-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.59 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|