C19H18BrNO3S — CID 5107196
3-(4-bromophenyl)-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one (PubChem CID 5107196) has the molecular formula C19H18BrNO3S and a molecular weight of 420.33 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one.
| Compound Name | 3-(4-bromophenyl)-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5107196 |
| Molecular Formula | C19H18BrNO3S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 3-(4-bromophenyl)-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Br)cc1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H18BrNO3S/c20-17-8-3-15(4-9-17)5-12-19(22)16-6-10-18(11-7-16)25(23,24)21-13-1-2-14-21/h3-12H,1-2,13-14H2 |
| InChIKey | PVFIAQAYMRGDHZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|