C21H23NO5S — CID 6215435
(E)-3-(3-ethoxy-4-hydroxyphenyl)-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one (PubChem CID 6215435) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is (E)-3-(3-ethoxy-4-hydroxyphenyl)-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-ethoxy-4-hydroxyphenyl)-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6215435 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (E)-3-(3-ethoxy-4-hydroxyphenyl)-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)ccc1O |
| InChI | InChI=1S/C21H23NO5S/c1-2-27-21-15-16(6-12-20(21)24)5-11-19(23)17-7-9-18(10-8-17)28(25,26)22-13-3-4-14-22/h5-12,15,24H,2-4,13-14H2,1H3/b11-5+ |
| InChIKey | LLQZKCNVBSGIBP-VZUCSPMQSA-N |
| XLogP | 3.47 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|