C27H35NO5S — CID 3928176
1-[4-(azepan-1-ylsulfonyl)phenyl]-3-(2,4-dipropoxyphenyl)prop-2-en-1-one (PubChem CID 3928176) has the molecular formula C27H35NO5S and a molecular weight of 485.65 g/mol. Its IUPAC name is 1-[4-(azepan-1-ylsulfonyl)phenyl]-3-(2,4-dipropoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(azepan-1-ylsulfonyl)phenyl]-3-(2,4-dipropoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3928176 |
| Molecular Formula | C27H35NO5S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 1-[4-(azepan-1-ylsulfonyl)phenyl]-3-(2,4-dipropoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(C=CC(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)c(OCCC)c1 |
| InChI | InChI=1S/C27H35NO5S/c1-3-19-32-24-13-9-23(27(21-24)33-20-4-2)12-16-26(29)22-10-14-25(15-11-22)34(30,31)28-17-7-5-6-8-18-28/h9-16,21H,3-8,17-20H2,1-2H3 |
| InChIKey | FJFIGQDGILTOFG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|