C29H30N2O6S — CID 3934228
3-[4-(4-tert-butylphenoxy)-3-nitrophenyl]-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one (PubChem CID 3934228) has the molecular formula C29H30N2O6S and a molecular weight of 534.63 g/mol. Its IUPAC name is 3-[4-(4-tert-butylphenoxy)-3-nitrophenyl]-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one.
| Compound Name | 3-[4-(4-tert-butylphenoxy)-3-nitrophenyl]-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3934228 |
| Molecular Formula | C29H30N2O6S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 3-[4-(4-tert-butylphenoxy)-3-nitrophenyl]-1-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-en-1-one |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(C=CC(=O)c3ccc(S(=O)(=O)N4CCCC4)cc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H30N2O6S/c1-29(2,3)23-10-12-24(13-11-23)37-28-17-7-21(20-26(28)31(33)34)6-16-27(32)22-8-14-25(15-9-22)38(35,36)30-18-4-5-19-30/h6-17,20H,4-5,18-19H2,1-3H3 |
| InChIKey | HCVZFBVZSANFCP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|