C19H22N2O5S — CID 3652947
1-[4-(3,5-dimethylphenoxy)-3-nitrophenyl]sulfonylpiperidine (PubChem CID 3652947) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylphenoxy)-3-nitrophenyl]sulfonylpiperidine.
| Compound Name | 1-[4-(3,5-dimethylphenoxy)-3-nitrophenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 3652947 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-[4-(3,5-dimethylphenoxy)-3-nitrophenyl]sulfonylpiperidine |
| SMILES | Cc1cc(C)cc(Oc2ccc(S(=O)(=O)N3CCCCC3)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H22N2O5S/c1-14-10-15(2)12-16(11-14)26-19-7-6-17(13-18(19)21(22)23)27(24,25)20-8-4-3-5-9-20/h6-7,10-13H,3-5,8-9H2,1-2H3 |
| InChIKey | IJMZARFMQJICAI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|