C20H23N3O5S — CID 7963193
1-[4-(2,3-dihydro-1H-inden-5-yloxy)-3-nitrophenyl]sulfonyl-4-methylpiperazine (PubChem CID 7963193) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1H-inden-5-yloxy)-3-nitrophenyl]sulfonyl-4-methylpiperazine.
| Compound Name | 1-[4-(2,3-dihydro-1H-inden-5-yloxy)-3-nitrophenyl]sulfonyl-4-methylpiperazine |
|---|---|
| PubChem CID | 7963193 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-[4-(2,3-dihydro-1H-inden-5-yloxy)-3-nitrophenyl]sulfonyl-4-methylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(Oc3ccc4c(c3)CCC4)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H23N3O5S/c1-21-9-11-22(12-10-21)29(26,27)18-7-8-20(19(14-18)23(24)25)28-17-6-5-15-3-2-4-16(15)13-17/h5-8,13-14H,2-4,9-12H2,1H3 |
| InChIKey | QHGXABYDWOZJCH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|