C23H22N2O6S — CID 3655786
1-[3-nitro-4-(3-phenoxyphenoxy)phenyl]sulfonylpiperidine (PubChem CID 3655786) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is 1-[3-nitro-4-(3-phenoxyphenoxy)phenyl]sulfonylpiperidine.
| Compound Name | 1-[3-nitro-4-(3-phenoxyphenoxy)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 3655786 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 1-[3-nitro-4-(3-phenoxyphenoxy)phenyl]sulfonylpiperidine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1Oc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H22N2O6S/c26-25(27)22-17-21(32(28,29)24-14-5-2-6-15-24)12-13-23(22)31-20-11-7-10-19(16-20)30-18-8-3-1-4-9-18/h1,3-4,7-13,16-17H,2,5-6,14-15H2 |
| InChIKey | PVVZQRMSGHYYIM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|