C19H22N2O6S — CID 9250814
1-[3-nitro-4-(2-propoxyphenoxy)phenyl]sulfonylpyrrolidine (PubChem CID 9250814) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is 1-[3-nitro-4-(2-propoxyphenoxy)phenyl]sulfonylpyrrolidine.
| Compound Name | 1-[3-nitro-4-(2-propoxyphenoxy)phenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 9250814 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-[3-nitro-4-(2-propoxyphenoxy)phenyl]sulfonylpyrrolidine |
| SMILES | CCCOc1ccccc1Oc1ccc(S(=O)(=O)N2CCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N2O6S/c1-2-13-26-18-7-3-4-8-19(18)27-17-10-9-15(14-16(17)21(22)23)28(24,25)20-11-5-6-12-20/h3-4,7-10,14H,2,5-6,11-13H2,1H3 |
| InChIKey | VUPBBGAGCVHJAM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|