C18H19ClN2O6S — CID 3412411
1-[4-[2-(2-chlorophenoxy)ethoxy]-3-nitrophenyl]sulfonylpyrrolidine (PubChem CID 3412411) has the molecular formula C18H19ClN2O6S and a molecular weight of 426.88 g/mol. Its IUPAC name is 1-[4-[2-(2-chlorophenoxy)ethoxy]-3-nitrophenyl]sulfonylpyrrolidine.
| Compound Name | 1-[4-[2-(2-chlorophenoxy)ethoxy]-3-nitrophenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 3412411 |
| Molecular Formula | C18H19ClN2O6S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 1-[4-[2-(2-chlorophenoxy)ethoxy]-3-nitrophenyl]sulfonylpyrrolidine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2)ccc1OCCOc1ccccc1Cl |
| InChI | InChI=1S/C18H19ClN2O6S/c19-15-5-1-2-6-17(15)26-11-12-27-18-8-7-14(13-16(18)21(22)23)28(24,25)20-9-3-4-10-20/h1-2,5-8,13H,3-4,9-12H2 |
| InChIKey | KWPFTVCJWVIPNR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|