C17H16Cl2N2O5S — CID 3941390
1-[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]sulfonylpyrrolidine (PubChem CID 3941390) has the molecular formula C17H16Cl2N2O5S and a molecular weight of 431.30 g/mol. Its IUPAC name is 1-[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]sulfonylpyrrolidine.
| Compound Name | 1-[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 3941390 |
| Molecular Formula | C17H16Cl2N2O5S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 1-[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]sulfonylpyrrolidine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O5S/c18-13-4-3-12(15(19)9-13)11-26-17-6-5-14(10-16(17)21(22)23)27(24,25)20-7-1-2-8-20/h3-6,9-10H,1-2,7-8,11H2 |
| InChIKey | CQWSQXJJSQNNCG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|