C17H16Cl2N2O6S — CID 71905324
4-[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]sulfonylmorpholine (PubChem CID 71905324) has the molecular formula C17H16Cl2N2O6S and a molecular weight of 447.30 g/mol. Its IUPAC name is 4-[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]sulfonylmorpholine.
| Compound Name | 4-[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 71905324 |
| Molecular Formula | C17H16Cl2N2O6S |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 4-[4-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]sulfonylmorpholine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCOCC2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O6S/c18-13-2-1-12(15(19)9-13)11-27-17-4-3-14(10-16(17)21(22)23)28(24,25)20-5-7-26-8-6-20/h1-4,9-10H,5-8,11H2 |
| InChIKey | SOISUSHPNYWVIV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|