C18H17ClN4O6S — CID 4804832
4-[4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]-3-nitrophenyl]sulfonylmorpholine (PubChem CID 4804832) has the molecular formula C18H17ClN4O6S and a molecular weight of 452.88 g/mol. Its IUPAC name is 4-[4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]-3-nitrophenyl]sulfonylmorpholine.
| Compound Name | 4-[4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]-3-nitrophenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 4804832 |
| Molecular Formula | C18H17ClN4O6S |
| Molecular Weight | 452.88 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 4-[4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]-3-nitrophenyl]sulfonylmorpholine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCOCC2)ccc1OCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C18H17ClN4O6S/c19-13-1-4-18-20-14(11-21(18)10-13)12-29-17-3-2-15(9-16(17)23(24)25)30(26,27)22-5-7-28-8-6-22/h1-4,9-11H,5-8,12H2 |
| InChIKey | KDFDEGLETLFVPP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.88 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|