C20H18ClN3O5S2 — CID 4825301
2-(2-chlorophenyl)-4-[(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)methyl]-1,3-thiazole (PubChem CID 4825301) has the molecular formula C20H18ClN3O5S2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-[(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-(2-chlorophenyl)-4-[(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 4825301 |
| Molecular Formula | C20H18ClN3O5S2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 2-(2-chlorophenyl)-4-[(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)methyl]-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2)ccc1OCc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C20H18ClN3O5S2/c21-17-6-2-1-5-16(17)20-22-14(13-30-20)12-29-19-8-7-15(11-18(19)24(25)26)31(27,28)23-9-3-4-10-23/h1-2,5-8,11,13H,3-4,9-10,12H2 |
| InChIKey | DMWYHNKHRLLMJU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|