C24H22N2O6S — CID 16504528
2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)-1-(4-phenylphenyl)ethanone (PubChem CID 16504528) has the molecular formula C24H22N2O6S and a molecular weight of 466.52 g/mol. Its IUPAC name is 2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)-1-(4-phenylphenyl)ethanone.
| Compound Name | 2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)-1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 16504528 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)-1-(4-phenylphenyl)ethanone |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCCC2)cc1[N+](=O)[O-])c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O6S/c27-23(20-10-8-19(9-11-20)18-6-2-1-3-7-18)17-32-24-13-12-21(16-22(24)26(28)29)33(30,31)25-14-4-5-15-25/h1-3,6-13,16H,4-5,14-15,17H2 |
| InChIKey | FIPJNQILJOORFK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|