C19H27N3O6S — CID 7555537
1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone (PubChem CID 7555537) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 7555537 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)ethanone |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)COc1ccc(S(=O)(=O)N2CCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H27N3O6S/c1-14-6-5-7-15(2)21(14)19(23)13-28-18-9-8-16(12-17(18)22(24)25)29(26,27)20-10-3-4-11-20/h8-9,12,14-15H,3-7,10-11,13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | JTYCORHQPZHZOZ-GJZGRUSLSA-N |
| XLogP | 2.55 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|