C17H25N3O6S — CID 7229741
2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-[(2S)-pentan-2-yl]acetamide (PubChem CID 7229741) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-[(2S)-pentan-2-yl]acetamide.
| Compound Name | 2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-[(2S)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 7229741 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)-N-[(2S)-pentan-2-yl]acetamide |
| SMILES | CCC[C@H](C)NC(=O)COc1ccc(S(=O)(=O)N2CCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N3O6S/c1-3-6-13(2)18-17(21)12-26-16-8-7-14(11-15(16)20(22)23)27(24,25)19-9-4-5-10-19/h7-8,11,13H,3-6,9-10,12H2,1-2H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | XNUYDCIZOGBTTN-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|