C19H20N4O9S — CID 3953912
N-(4-methoxy-2-nitrophenyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide (PubChem CID 3953912) has the molecular formula C19H20N4O9S and a molecular weight of 480.46 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 3953912 |
| Molecular Formula | C19H20N4O9S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N4O9S/c1-31-13-4-6-15(16(10-13)22(25)26)20-19(24)12-32-18-7-5-14(11-17(18)23(27)28)33(29,30)21-8-2-3-9-21/h4-7,10-11H,2-3,8-9,12H2,1H3,(H,20,24) |
| InChIKey | VUXPOXOFTQDUAP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|