C19H23N3O6S — CID 71903822
2,4-dimethoxy-N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)aniline (PubChem CID 71903822) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)aniline.
| Compound Name | 2,4-dimethoxy-N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)aniline |
|---|---|
| PubChem CID | 71903822 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2,4-dimethoxy-N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)aniline |
| SMILES | COc1ccc(Nc2ccc(S(=O)(=O)N3CCCCC3)cc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C19H23N3O6S/c1-27-14-6-8-17(19(12-14)28-2)20-16-9-7-15(13-18(16)22(23)24)29(25,26)21-10-4-3-5-11-21/h6-9,12-13,20H,3-5,10-11H2,1-2H3 |
| InChIKey | HBPWOSNPPPSTMI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|