C16H24N4O4S — CID 9311427
N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperidin-1-amine (PubChem CID 9311427) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperidin-1-amine.
| Compound Name | N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperidin-1-amine |
|---|---|
| PubChem CID | 9311427 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)piperidin-1-amine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1NN1CCCCC1 |
| InChI | InChI=1S/C16H24N4O4S/c21-20(22)16-13-14(25(23,24)19-11-5-2-6-12-19)7-8-15(16)17-18-9-3-1-4-10-18/h7-8,13,17H,1-6,9-12H2 |
| InChIKey | XHJUGGQQSRINKL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|