C17H23N5O5S — CID 99815917
4-(azepan-1-ylsulfonyl)-N-[(1R)-1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-nitroaniline (PubChem CID 99815917) has the molecular formula C17H23N5O5S and a molecular weight of 409.47 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-[(1R)-1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-nitroaniline.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-[(1R)-1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 99815917 |
| Molecular Formula | C17H23N5O5S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-[(1R)-1-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-nitroaniline |
| SMILES | Cc1nc([C@@H](C)Nc2ccc(S(=O)(=O)N3CCCCCC3)cc2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C17H23N5O5S/c1-12(17-19-13(2)27-20-17)18-15-8-7-14(11-16(15)22(23)24)28(25,26)21-9-5-3-4-6-10-21/h7-8,11-12,18H,3-6,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | MBFXSBDUGSVPIQ-GFCCVEGCSA-N |
| XLogP | 3.02 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|