C17H22N4O4S2 — CID 133337287
N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-nitro-4-piperidin-1-ylsulfonylaniline (PubChem CID 133337287) has the molecular formula C17H22N4O4S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-nitro-4-piperidin-1-ylsulfonylaniline.
| Compound Name | N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-nitro-4-piperidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 133337287 |
| Molecular Formula | C17H22N4O4S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]-2-nitro-4-piperidin-1-ylsulfonylaniline |
| SMILES | Cc1cnc(C(C)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C17H22N4O4S2/c1-12-11-18-17(26-12)13(2)19-15-7-6-14(10-16(15)21(22)23)27(24,25)20-8-4-3-5-9-20/h6-7,10-11,13,19H,3-5,8-9H2,1-2H3 |
| InChIKey | RQEUHKKOMYETKP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|