C16H25N3O4S2 — CID 133311861
4-(azepan-1-ylsulfonyl)-N-(1-methylsulfanylpropan-2-yl)-2-nitroaniline (PubChem CID 133311861) has the molecular formula C16H25N3O4S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-(1-methylsulfanylpropan-2-yl)-2-nitroaniline.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-(1-methylsulfanylpropan-2-yl)-2-nitroaniline |
|---|---|
| PubChem CID | 133311861 |
| Molecular Formula | C16H25N3O4S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-(1-methylsulfanylpropan-2-yl)-2-nitroaniline |
| SMILES | CSCC(C)Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N3O4S2/c1-13(12-24-2)17-15-8-7-14(11-16(15)19(20)21)25(22,23)18-9-5-3-4-6-10-18/h7-8,11,13,17H,3-6,9-10,12H2,1-2H3 |
| InChIKey | URUYEWKIWHARSP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|