C19H25N3O5S — CID 9340656
N-[(2S)-4-(furan-2-yl)butan-2-yl]-2-nitro-4-piperidin-1-ylsulfonylaniline (PubChem CID 9340656) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is N-[(2S)-4-(furan-2-yl)butan-2-yl]-2-nitro-4-piperidin-1-ylsulfonylaniline.
| Compound Name | N-[(2S)-4-(furan-2-yl)butan-2-yl]-2-nitro-4-piperidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 9340656 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[(2S)-4-(furan-2-yl)butan-2-yl]-2-nitro-4-piperidin-1-ylsulfonylaniline |
| SMILES | C[C@@H](CCc1ccco1)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H25N3O5S/c1-15(7-8-16-6-5-13-27-16)20-18-10-9-17(14-19(18)22(23)24)28(25,26)21-11-3-2-4-12-21/h5-6,9-10,13-15,20H,2-4,7-8,11-12H2,1H3/t15-/m0/s1 |
| InChIKey | LQHSHGWYXOJLGF-HNNXBMFYSA-N |
| XLogP | 3.80 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|