C13H19N3O6S — CID 95329271
(2R)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propan-1-ol (PubChem CID 95329271) has the molecular formula C13H19N3O6S and a molecular weight of 345.38 g/mol. Its IUPAC name is (2R)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propan-1-ol.
| Compound Name | (2R)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propan-1-ol |
|---|---|
| PubChem CID | 95329271 |
| Molecular Formula | C13H19N3O6S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (2R)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propan-1-ol |
| SMILES | C[C@H](CO)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O6S/c1-10(9-17)14-12-3-2-11(8-13(12)16(18)19)23(20,21)15-4-6-22-7-5-15/h2-3,8,10,14,17H,4-7,9H2,1H3/t10-/m1/s1 |
| InChIKey | ORZYGCYXCFNAJK-SNVBAGLBSA-N |
| XLogP | 0.41 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|