C18H23N3O7S — CID 31659185
(2S)-2-(furan-2-ylmethyl)-3-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propan-1-ol (PubChem CID 31659185) has the molecular formula C18H23N3O7S and a molecular weight of 425.46 g/mol. Its IUPAC name is (2S)-2-(furan-2-ylmethyl)-3-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propan-1-ol.
| Compound Name | (2S)-2-(furan-2-ylmethyl)-3-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propan-1-ol |
|---|---|
| PubChem CID | 31659185 |
| Molecular Formula | C18H23N3O7S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | (2S)-2-(furan-2-ylmethyl)-3-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propan-1-ol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCOCC2)ccc1NC[C@@H](CO)Cc1ccco1 |
| InChI | InChI=1S/C18H23N3O7S/c22-13-14(10-15-2-1-7-28-15)12-19-17-4-3-16(11-18(17)21(23)24)29(25,26)20-5-8-27-9-6-20/h1-4,7,11,14,19,22H,5-6,8-10,12-13H2/t14-/m0/s1 |
| InChIKey | ICXHFOMPBZCROI-AWEZNQCLSA-N |
| XLogP | 1.47 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|