C22H28N4O9S2 — CID 98418781
[2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-4-methylsulfanyl-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)butanoate (PubChem CID 98418781) has the molecular formula C22H28N4O9S2 and a molecular weight of 556.62 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-4-methylsulfanyl-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)butanoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-4-methylsulfanyl-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)butanoate |
|---|---|
| PubChem CID | 98418781 |
| Molecular Formula | C22H28N4O9S2 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-4-methylsulfanyl-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)butanoate |
| SMILES | CSCC[C@H](Nc1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-])C(=O)OCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C22H28N4O9S2/c1-36-12-6-19(22(28)35-15-21(27)23-14-16-3-2-9-34-16)24-18-5-4-17(13-20(18)26(29)30)37(31,32)25-7-10-33-11-8-25/h2-5,9,13,19,24H,6-8,10-12,14-15H2,1H3,(H,23,27)/t19-/m0/s1 |
| InChIKey | VCGLAKAENSUJHZ-IBGZPJMESA-N |
| XLogP | 1.60 |
| TPSA | 170.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|