C25H29N5O8S — CID 4566238
[2-(dimethylamino)-2-oxoethyl] 3-(1H-indol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoate (PubChem CID 4566238) has the molecular formula C25H29N5O8S and a molecular weight of 559.60 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] 3-(1H-indol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] 3-(1H-indol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoate |
|---|---|
| PubChem CID | 4566238 |
| Molecular Formula | C25H29N5O8S |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] 3-(1H-indol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoate |
| SMILES | CN(C)C(=O)COC(=O)C(Cc1c[nH]c2ccccc12)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H29N5O8S/c1-28(2)24(31)16-38-25(32)22(13-17-15-26-20-6-4-3-5-19(17)20)27-21-8-7-18(14-23(21)30(33)34)39(35,36)29-9-11-37-12-10-29/h3-8,14-15,22,26-27H,9-13,16H2,1-2H3 |
| InChIKey | NOXSOHDSNCXQRY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 164.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|