C17H16N4O7 — CID 45049886
2-(2,4-dinitroanilino)-3-(1H-indol-3-yl)propanoic acid;hydrate (PubChem CID 45049886) has the molecular formula C17H16N4O7 and a molecular weight of 388.34 g/mol. Its IUPAC name is 2-(2,4-dinitroanilino)-3-(1H-indol-3-yl)propanoic acid;hydrate.
| Compound Name | 2-(2,4-dinitroanilino)-3-(1H-indol-3-yl)propanoic acid;hydrate |
|---|---|
| PubChem CID | 45049886 |
| Molecular Formula | C17H16N4O7 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-(2,4-dinitroanilino)-3-(1H-indol-3-yl)propanoic acid;hydrate |
| SMILES | O.O=C(O)C(Cc1c[nH]c2ccccc12)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N4O6.H2O/c22-17(23)15(7-10-9-18-13-4-2-1-3-12(10)13)19-14-6-5-11(20(24)25)8-16(14)21(26)27;/h1-6,8-9,15,18-19H,7H2,(H,22,23);1H2 |
| InChIKey | ORFPGZVTWSLRQV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 182.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|