C18H15ClF3N3O4 — CID 75063403
3-(1H-indol-3-yl)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoic acid;hydrochloride (PubChem CID 75063403) has the molecular formula C18H15ClF3N3O4 and a molecular weight of 429.78 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoic acid;hydrochloride.
| Compound Name | 3-(1H-indol-3-yl)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 75063403 |
| Molecular Formula | C18H15ClF3N3O4 |
| Molecular Weight | 429.78 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)C(Cc1c[nH]c2ccccc12)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14F3N3O4.ClH/c19-18(20,21)11-5-6-14(16(8-11)24(27)28)23-15(17(25)26)7-10-9-22-13-4-2-1-3-12(10)13;/h1-6,8-9,15,22-23H,7H2,(H,25,26);1H |
| InChIKey | ULEOXHICAFQKGJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.78 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|