C21H21N3O6 — CID 84549618
3-(1H-indol-3-yl)-2-[4-(2-nitrophenoxy)butanoylamino]propanoic acid (PubChem CID 84549618) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-[4-(2-nitrophenoxy)butanoylamino]propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-[4-(2-nitrophenoxy)butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 84549618 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-[4-(2-nitrophenoxy)butanoylamino]propanoic acid |
| SMILES | O=C(CCCOc1ccccc1[N+](=O)[O-])NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H21N3O6/c25-20(10-5-11-30-19-9-4-3-8-18(19)24(28)29)23-17(21(26)27)12-14-13-22-16-7-2-1-6-15(14)16/h1-4,6-9,13,17,22H,5,10-12H2,(H,23,25)(H,26,27) |
| InChIKey | XYRZGFTXDKKYLP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|