C25H21N3O6 — CID 69426258
(2-nitrophenyl) (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 69426258) has the molecular formula C25H21N3O6 and a molecular weight of 459.46 g/mol. Its IUPAC name is (2-nitrophenyl) (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (2-nitrophenyl) (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 69426258 |
| Molecular Formula | C25H21N3O6 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (2-nitrophenyl) (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)Oc1ccccc1[N+](=O)[O-])OCc1ccccc1 |
| InChI | InChI=1S/C25H21N3O6/c29-24(34-23-13-7-6-12-22(23)28(31)32)21(14-18-15-26-20-11-5-4-10-19(18)20)27-25(30)33-16-17-8-2-1-3-9-17/h1-13,15,21,26H,14,16H2,(H,27,30)/t21-/m0/s1 |
| InChIKey | DFFPCLXLSPHOFZ-NRFANRHFSA-N |
| XLogP | 4.52 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|