C30H26N2O7 — CID 102428389
(2-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 102428389) has the molecular formula C30H26N2O7 and a molecular weight of 526.55 g/mol. Its IUPAC name is (2-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | (2-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 102428389 |
| Molecular Formula | C30H26N2O7 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | (2-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | O=C(N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)Oc1ccccc1[N+](=O)[O-])OCc1ccccc1 |
| InChI | InChI=1S/C30H26N2O7/c33-29(39-28-14-8-7-13-27(28)32(35)36)26(31-30(34)38-21-24-11-5-2-6-12-24)19-22-15-17-25(18-16-22)37-20-23-9-3-1-4-10-23/h1-18,26H,19-21H2,(H,31,34)/t26-/m0/s1 |
| InChIKey | PORKIVKUNBABRM-SANMLTNESA-N |
| XLogP | 5.62 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|