C25H24N2O5 — CID 11339458
benzyl N-[(2S)-4-amino-3,4-dioxo-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate (PubChem CID 11339458) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is benzyl N-[(2S)-4-amino-3,4-dioxo-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-4-amino-3,4-dioxo-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 11339458 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | benzyl N-[(2S)-4-amino-3,4-dioxo-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate |
| SMILES | NC(=O)C(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H24N2O5/c26-24(29)23(28)22(27-25(30)32-17-20-9-5-2-6-10-20)15-18-11-13-21(14-12-18)31-16-19-7-3-1-4-8-19/h1-14,22H,15-17H2,(H2,26,29)(H,27,30)/t22-/m0/s1 |
| InChIKey | WBYQPPJGQJFIGU-QFIPXVFZSA-N |
| XLogP | 3.16 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|