C36H32N4O4 — CID 126008384
benzyl N-[(2R)-1-oxo-1-(4-phenyldiazenylanilino)-3-(4-phenylmethoxyphenyl)propan-2-yl]carbamate (PubChem CID 126008384) has the molecular formula C36H32N4O4 and a molecular weight of 584.68 g/mol. Its IUPAC name is benzyl N-[(2R)-1-oxo-1-(4-phenyldiazenylanilino)-3-(4-phenylmethoxyphenyl)propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-oxo-1-(4-phenyldiazenylanilino)-3-(4-phenylmethoxyphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 126008384 |
| Molecular Formula | C36H32N4O4 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | benzyl N-[(2R)-1-oxo-1-(4-phenyldiazenylanilino)-3-(4-phenylmethoxyphenyl)propan-2-yl]carbamate |
| SMILES | O=C(N[C@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)Nc1ccc(/N=N/c2ccccc2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C36H32N4O4/c41-35(37-30-18-20-32(21-19-30)40-39-31-14-8-3-9-15-31)34(38-36(42)44-26-29-12-6-2-7-13-29)24-27-16-22-33(23-17-27)43-25-28-10-4-1-5-11-28/h1-23,34H,24-26H2,(H,37,41)(H,38,42)/b40-39+/t34-/m1/s1 |
| InChIKey | KHRHFYUNMZVJGP-GQWACYRSSA-N |
| XLogP | 8.16 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|