C25H26N4O3 — CID 126005874
benzyl N-[(2S)-3-methyl-1-oxo-1-(4-phenyldiazenylanilino)butan-2-yl]carbamate (PubChem CID 126005874) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is benzyl N-[(2S)-3-methyl-1-oxo-1-(4-phenyldiazenylanilino)butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-methyl-1-oxo-1-(4-phenyldiazenylanilino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 126005874 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | benzyl N-[(2S)-3-methyl-1-oxo-1-(4-phenyldiazenylanilino)butan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N4O3/c1-18(2)23(27-25(31)32-17-19-9-5-3-6-10-19)24(30)26-20-13-15-22(16-14-20)29-28-21-11-7-4-8-12-21/h3-16,18,23H,17H2,1-2H3,(H,26,30)(H,27,31)/b29-28+/t23-/m0/s1 |
| InChIKey | QJOPKNSXRPLCFK-XHWLHZJSSA-N |
| XLogP | 5.99 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|