C24H31N3O4 — CID 34596309
benzyl N-[(2S)-3-methyl-1-[4-(3-methylbutanoylamino)anilino]-1-oxobutan-2-yl]carbamate (PubChem CID 34596309) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is benzyl N-[(2S)-3-methyl-1-[4-(3-methylbutanoylamino)anilino]-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-methyl-1-[4-(3-methylbutanoylamino)anilino]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 34596309 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | benzyl N-[(2S)-3-methyl-1-[4-(3-methylbutanoylamino)anilino]-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)[C@@H](NC(=O)OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C24H31N3O4/c1-16(2)14-21(28)25-19-10-12-20(13-11-19)26-23(29)22(17(3)4)27-24(30)31-15-18-8-6-5-7-9-18/h5-13,16-17,22H,14-15H2,1-4H3,(H,25,28)(H,26,29)(H,27,30)/t22-/m0/s1 |
| InChIKey | FRAVJBJDMXEFHA-QFIPXVFZSA-N |
| XLogP | 4.56 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |