C20H24N4O5 — CID 59873427
(2S)-3-[4-[2-(diaminomethylideneamino)ethoxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 59873427) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is (2S)-3-[4-[2-(diaminomethylideneamino)ethoxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-[4-[2-(diaminomethylideneamino)ethoxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 59873427 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (2S)-3-[4-[2-(diaminomethylideneamino)ethoxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | NC(N)=NCCOc1ccc(C[C@H](NC(=O)OCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H24N4O5/c21-19(22)23-10-11-28-16-8-6-14(7-9-16)12-17(18(25)26)24-20(27)29-13-15-4-2-1-3-5-15/h1-9,17H,10-13H2,(H,24,27)(H,25,26)(H4,21,22,23)/t17-/m0/s1 |
| InChIKey | KIXGSGDKASBLHR-KRWDZBQOSA-N |
| XLogP | 1.26 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|