C21H27NO5 — CID 90811046
ethane;2-[[4-(methoxymethyl)phenyl]methoxycarbonylamino]-3-phenylpropanoic acid (PubChem CID 90811046) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is ethane;2-[[4-(methoxymethyl)phenyl]methoxycarbonylamino]-3-phenylpropanoic acid.
| Compound Name | ethane;2-[[4-(methoxymethyl)phenyl]methoxycarbonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90811046 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | ethane;2-[[4-(methoxymethyl)phenyl]methoxycarbonylamino]-3-phenylpropanoic acid |
| SMILES | CC.COCc1ccc(COC(=O)NC(Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H21NO5.C2H6/c1-24-12-15-7-9-16(10-8-15)13-25-19(23)20-17(18(21)22)11-14-5-3-2-4-6-14;1-2/h2-10,17H,11-13H2,1H3,(H,20,23)(H,21,22);1-2H3 |
| InChIKey | BYUCLVGZTGGYME-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |