C21H24N2O5 — CID 59254472
(2S)-3-phenyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoic acid (PubChem CID 59254472) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59254472 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (2S)-3-phenyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoic acid |
| SMILES | CC[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H24N2O5/c1-2-17(23-21(27)28-14-16-11-7-4-8-12-16)19(24)22-18(20(25)26)13-15-9-5-3-6-10-15/h3-12,17-18H,2,13-14H2,1H3,(H,22,24)(H,23,27)(H,25,26)/t17-,18-/m0/s1 |
| InChIKey | YHIDOKXLLUUWNS-ROUUACIJSA-N |
| XLogP | 2.50 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |