C23H30BN2O7 — CID 67335724
CID 67335724 (PubChem CID 67335724) has the molecular formula C23H30BN2O7 and a molecular weight of 457.31 g/mol.
| Compound Name | CID 67335724 |
|---|---|
| PubChem CID | 67335724 |
| Molecular Formula | C23H30BN2O7 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | — |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O.O[B]O |
| InChI | InChI=1S/C23H28N2O5.BH2O2/c1-16(2)13-19(25-23(29)30-15-18-11-7-4-8-12-18)21(26)24-20(22(27)28)14-17-9-5-3-6-10-17;2-1-3/h3-12,16,19-20H,13-15H2,1-2H3,(H,24,26)(H,25,29)(H,27,28);2-3H/t19-,20-;/m0./s1 |
| InChIKey | ZYVOAWHPZKMMGF-FKLPMGAJSA-N |
| XLogP | 1.64 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|