C44H50N2O10 — CID 67632044
2,4-bis(2,6-dimethylphenyl)-3-oxopentanedioic acid;(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 67632044) has the molecular formula C44H50N2O10 and a molecular weight of 766.89 g/mol. Its IUPAC name is 2,4-bis(2,6-dimethylphenyl)-3-oxopentanedioic acid;(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2,4-bis(2,6-dimethylphenyl)-3-oxopentanedioic acid;(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67632044 |
| Molecular Formula | C44H50N2O10 |
| Molecular Weight | 766.89 g/mol |
| Exact Mass | 766.35 |
| IUPAC Name | 2,4-bis(2,6-dimethylphenyl)-3-oxopentanedioic acid;(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O.Cc1cccc(C)c1C(C(=O)O)C(=O)C(C(=O)O)c1c(C)cccc1C |
| InChI | InChI=1S/C23H28N2O5.C21H22O5/c1-16(2)13-19(25-23(29)30-15-18-11-7-4-8-12-18)21(26)24-20(22(27)28)14-17-9-5-3-6-10-17;1-11-7-5-8-12(2)15(11)17(20(23)24)19(22)18(21(25)26)16-13(3)9-6-10-14(16)4/h3-12,16,19-20H,13-15H2,1-2H3,(H,24,26)(H,25,29)(H,27,28);5-10,17-18H,1-4H3,(H,23,24)(H,25,26)/t19-,20-;/m0./s1 |
| InChIKey | YMSVMFKCQBDSGK-FKLPMGAJSA-N |
| XLogP | 6.67 |
| TPSA | 196.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.89 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|