C38H45N3O8 — CID 90663135
benzyl (4S)-4-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoyl]amino]-2,3-dioxo-5-phenylpentanoate (PubChem CID 90663135) has the molecular formula C38H45N3O8 and a molecular weight of 671.79 g/mol. Its IUPAC name is benzyl (4S)-4-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoyl]amino]-2,3-dioxo-5-phenylpentanoate.
| Compound Name | benzyl (4S)-4-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoyl]amino]-2,3-dioxo-5-phenylpentanoate |
|---|---|
| PubChem CID | 90663135 |
| Molecular Formula | C38H45N3O8 |
| Molecular Weight | 671.79 g/mol |
| Exact Mass | 671.32 |
| IUPAC Name | benzyl (4S)-4-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoyl]amino]-2,3-dioxo-5-phenylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)C(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H45N3O8/c1-25(2)20-31(40-36(45)32(21-26(3)4)41-38(47)49-24-29-18-12-7-13-19-29)35(44)39-30(22-27-14-8-5-9-15-27)33(42)34(43)37(46)48-23-28-16-10-6-11-17-28/h5-19,25-26,30-32H,20-24H2,1-4H3,(H,39,44)(H,40,45)(H,41,47)/t30-,31-,32-/m0/s1 |
| InChIKey | HWXCDQYWPUAMLZ-CPCREDONSA-N |
| XLogP | 4.47 |
| TPSA | 156.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.79 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|