C34H46N4O7 — CID 102236151
benzyl N-[(2S)-1-[[(2S)-1-[[(4S)-1-anilino-6-methyl-1,2,3-trioxoheptan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 102236151) has the molecular formula C34H46N4O7 and a molecular weight of 622.76 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-1-[[(4S)-1-anilino-6-methyl-1,2,3-trioxoheptan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-1-[[(4S)-1-anilino-6-methyl-1,2,3-trioxoheptan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 102236151 |
| Molecular Formula | C34H46N4O7 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-1-[[(4S)-1-anilino-6-methyl-1,2,3-trioxoheptan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)C(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C34H46N4O7/c1-21(2)17-26(29(39)30(40)33(43)35-25-15-11-8-12-16-25)36-31(41)27(18-22(3)4)37-32(42)28(19-23(5)6)38-34(44)45-20-24-13-9-7-10-14-24/h7-16,21-23,26-28H,17-20H2,1-6H3,(H,35,43)(H,36,41)(H,37,42)(H,38,44)/t26-,27-,28-/m0/s1 |
| InChIKey | HYISDYQCZADDEO-KCHLEUMXSA-N |
| XLogP | 4.17 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|